C26H31NO8 — CID 70430745
(E)-but-2-enedioic acid;2-hydroxy-2,2-diphenylacetic acid;(3S)-6-methyl-6-azabicyclo[3.2.1]octan-3-ol (PubChem CID 70430745) has the molecular formula C26H31NO8 and a molecular weight of 485.53 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;2-hydroxy-2,2-diphenylacetic acid;(3S)-6-methyl-6-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | (E)-but-2-enedioic acid;2-hydroxy-2,2-diphenylacetic acid;(3S)-6-methyl-6-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 70430745 |
| Molecular Formula | C26H31NO8 |
| Molecular Weight | 485.53 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | (E)-but-2-enedioic acid;2-hydroxy-2,2-diphenylacetic acid;(3S)-6-methyl-6-azabicyclo[3.2.1]octan-3-ol |
| SMILES | CN1CC2CC1C[C@@H](O)C2.O=C(O)/C=C/C(=O)O.O=C(O)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H12O3.C8H15NO.C4H4O4/c15-13(16)14(17,11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-9-5-6-2-7(9)4-8(10)3-6;5-3(6)1-2-4(7)8/h1-10,17H,(H,15,16);6-8,10H,2-5H2,1H3;1-2H,(H,5,6)(H,7,8)/b;;2-1+/t;6?,7?,8-;/m.0./s1 |
| InChIKey | OFEUZGXBDGCZJP-XHFMOJBNSA-N |
| XLogP | 2.18 |
| TPSA | 155.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.53 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|