C33H65FO4Si2 — CID 70430831
methyl (Z,7R)-7-[(1S,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoctyl]cyclopentyl]-7-fluorohept-5-enoate (PubChem CID 70430831) has the molecular formula C33H65FO4Si2 and a molecular weight of 601.05 g/mol. Its IUPAC name is methyl (Z,7R)-7-[(1S,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoctyl]cyclopentyl]-7-fluorohept-5-enoate.
| Compound Name | methyl (Z,7R)-7-[(1S,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoctyl]cyclopentyl]-7-fluorohept-5-enoate |
|---|---|
| PubChem CID | 70430831 |
| Molecular Formula | C33H65FO4Si2 |
| Molecular Weight | 601.05 g/mol |
| Exact Mass | 600.44 |
| IUPAC Name | methyl (Z,7R)-7-[(1S,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoctyl]cyclopentyl]-7-fluorohept-5-enoate |
| SMILES | CCCCC[C@@H](CC[C@@H]1[C@@H]([C@H](F)/C=C\CCCC(=O)OC)CC[C@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H65FO4Si2/c1-13-14-16-19-26(37-39(9,10)32(2,3)4)22-23-28-27(29(34)20-17-15-18-21-31(35)36-8)24-25-30(28)38-40(11,12)33(5,6)7/h17,20,26-30H,13-16,18-19,21-25H2,1-12H3/b20-17-/t26-,27-,28+,29+,30+/m0/s1 |
| InChIKey | DXFUMUZKOSQJDG-OCQFWGSCSA-N |
| XLogP | 10.39 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.05 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|