C21H33FO4 — CID 70430947
(5Z)-5-[(3aS,4R,5R,6aS)-4-[(E)-4-fluoro-1-hydroxyoct-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoic acid (PubChem CID 70430947) has the molecular formula C21H33FO4 and a molecular weight of 368.49 g/mol. Its IUPAC name is (5Z)-5-[(3aS,4R,5R,6aS)-4-[(E)-4-fluoro-1-hydroxyoct-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoic acid.
| Compound Name | (5Z)-5-[(3aS,4R,5R,6aS)-4-[(E)-4-fluoro-1-hydroxyoct-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoic acid |
|---|---|
| PubChem CID | 70430947 |
| Molecular Formula | C21H33FO4 |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | (5Z)-5-[(3aS,4R,5R,6aS)-4-[(E)-4-fluoro-1-hydroxyoct-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoic acid |
| SMILES | CCCCC(F)C/C=C(/O)[C@@H]1[C@H]2C/C(=C\CCCC(=O)O)C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C21H33FO4/c1-2-3-7-16(22)9-10-18(23)21-17-12-14(6-4-5-8-20(25)26)11-15(17)13-19(21)24/h6,10,15-17,19,21,23-24H,2-5,7-9,11-13H2,1H3,(H,25,26)/b14-6-,18-10+/t15-,16?,17-,19+,21-/m0/s1 |
| InChIKey | TUVSNRYTCLBTGI-WXIBJTDASA-N |
| XLogP | 4.93 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|