C10H12Cl3NO3S — CID 70431117
1,1,2-trichloroethyl (2S,5R)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 70431117) has the molecular formula C10H12Cl3NO3S and a molecular weight of 332.64 g/mol. Its IUPAC name is 1,1,2-trichloroethyl (2S,5R)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | 1,1,2-trichloroethyl (2S,5R)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 70431117 |
| Molecular Formula | C10H12Cl3NO3S |
| Molecular Weight | 332.64 g/mol |
| Exact Mass | 330.96 |
| IUPAC Name | 1,1,2-trichloroethyl (2S,5R)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(C)S[C@@H]2CC(=O)N2[C@H]1C(=O)OC(Cl)(Cl)CCl |
| InChI | InChI=1S/C10H12Cl3NO3S/c1-9(2)7(8(16)17-10(12,13)4-11)14-5(15)3-6(14)18-9/h6-7H,3-4H2,1-2H3/t6-,7+/m1/s1 |
| InChIKey | VBDJUIUUSPUNGY-RQJHMYQMSA-N |
| XLogP | 2.35 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.64 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|