About 2,4-diamino-N,1-bis[1-(dimethylamino)propyl]-6-oxopyridine-3-carboxamide
2,4-diamino-N,1-bis[1-(dimethylamino)propyl]-6-oxopyridine-3-carboxamide (PubChem CID 70431193) has the molecular formula C16H30N6O2
and a molecular weight of 338.46 g/mol. Its IUPAC name is 2,4-diamino-N,1-bis[1-(dimethylamino)propyl]-6-oxopyridine-3-carboxamide.
Molecular Properties
| Compound Name | 2,4-diamino-N,1-bis[1-(dimethylamino)propyl]-6-oxopyridine-3-carboxamide |
| PubChem CID | 70431193 |
| Molecular Formula | C16H30N6O2 |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | 2,4-diamino-N,1-bis[1-(dimethylamino)propyl]-6-oxopyridine-3-carboxamide |
| SMILES | CCC(NC(=O)c1c(N)cc(=O)n(C(CC)N(C)C)c1N)N(C)C |
| InChI | InChI=1S/C16H30N6O2/c1-7-11(20(3)4)19-16(24)14-10(17)9-13(23)22(15(14)18)12(8-2)21(5)6/h9,11-12H,7-8,17-18H2,1-6H3,(H,19,24) |
| InChIKey | BPPHWCQINOFSNA-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2,4-diamino-N,1-bis[1-(dimethylamino)propyl]-6-oxopyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diamino-N,1-bis[1-(dimethylamino)propyl]-6-oxopyridine-3-carboxamide?
The IUPAC name of 2,4-diamino-N,1-bis[1-(dimethylamino)propyl]-6-oxopyridine-3-carboxamide (CID 70431193) is 2,4-diamino-N,1-bis[1-(dimethylamino)propyl]-6-oxopyridine-3-carboxamide.
What is the SMILES notation for 2,4-diamino-N,1-bis[1-(dimethylamino)propyl]-6-oxopyridine-3-carboxamide?
The canonical SMILES for 2,4-diamino-N,1-bis[1-(dimethylamino)propyl]-6-oxopyridine-3-carboxamide is CCC(NC(=O)c1c(N)cc(=O)n(C(CC)N(C)C)c1N)N(C)C.
What is the InChIKey of 2,4-diamino-N,1-bis[1-(dimethylamino)propyl]-6-oxopyridine-3-carboxamide?
The InChIKey is BPPHWCQINOFSNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30N6O2/c1-7-11(20(3)4)19-16(24)14-10(17)9-13(23)22(15(14)18)12(8-2)21(5)6/h9,11-12H,7-8,17-18H2,1-6H3,(H,19,24).
What are the key properties of 2,4-diamino-N,1-bis[1-(dimethylamino)propyl]-6-oxopyridine-3-carboxamide?
2,4-diamino-N,1-bis[1-(dimethylamino)propyl]-6-oxopyridine-3-carboxamide has a molecular weight of 338.46 g/mol, XLogP of 0.51, 7 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diamino-N,1-bis[1-(dimethylamino)propyl]-6-oxopyridine-3-carboxamide is sourced from PubChem (CID 70431193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).