C16H28Cl3NO4SSi — CID 70431272
1-[1-[tert-butyl(dimethyl)silyl]-2-ethylsulfanyl-4-oxoazetidin-3-yl]ethyl 1,1,2-trichloroethyl carbonate (PubChem CID 70431272) has the molecular formula C16H28Cl3NO4SSi and a molecular weight of 464.92 g/mol. Its IUPAC name is 1-[1-[tert-butyl(dimethyl)silyl]-2-ethylsulfanyl-4-oxoazetidin-3-yl]ethyl 1,1,2-trichloroethyl carbonate.
| Compound Name | 1-[1-[tert-butyl(dimethyl)silyl]-2-ethylsulfanyl-4-oxoazetidin-3-yl]ethyl 1,1,2-trichloroethyl carbonate |
|---|---|
| PubChem CID | 70431272 |
| Molecular Formula | C16H28Cl3NO4SSi |
| Molecular Weight | 464.92 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | 1-[1-[tert-butyl(dimethyl)silyl]-2-ethylsulfanyl-4-oxoazetidin-3-yl]ethyl 1,1,2-trichloroethyl carbonate |
| SMILES | CCSC1C(C(C)OC(=O)OC(Cl)(Cl)CCl)C(=O)N1[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H28Cl3NO4SSi/c1-8-25-13-11(10(2)23-14(22)24-16(18,19)9-17)12(21)20(13)26(6,7)15(3,4)5/h10-11,13H,8-9H2,1-7H3 |
| InChIKey | IKVSFNZXPOSGJV-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.92 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|