C13H18INO6S — CID 70431506
2-methoxycarbonyloxypropan-2-yl (2S,5R,6R)-6-iodo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 70431506) has the molecular formula C13H18INO6S and a molecular weight of 443.26 g/mol. Its IUPAC name is 2-methoxycarbonyloxypropan-2-yl (2S,5R,6R)-6-iodo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | 2-methoxycarbonyloxypropan-2-yl (2S,5R,6R)-6-iodo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 70431506 |
| Molecular Formula | C13H18INO6S |
| Molecular Weight | 443.26 g/mol |
| Exact Mass | 442.99 |
| IUPAC Name | 2-methoxycarbonyloxypropan-2-yl (2S,5R,6R)-6-iodo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | COC(=O)OC(C)(C)OC(=O)[C@@H]1N2C(=O)[C@@H](I)[C@H]2SC1(C)C |
| InChI | InChI=1S/C13H18INO6S/c1-12(2)7(15-8(16)6(14)9(15)22-12)10(17)20-13(3,4)21-11(18)19-5/h6-7,9H,1-5H3/t6-,7+,9-/m1/s1 |
| InChIKey | XAGMFDCQLLRXBK-BKPPORCPSA-N |
| XLogP | 1.91 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|