C13H13NO3 — CID 70431515
4-(4,5,6,7-tetrahydrofuro[3,2-c]pyridin-4-yl)benzene-1,2-diol (PubChem CID 70431515) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is 4-(4,5,6,7-tetrahydrofuro[3,2-c]pyridin-4-yl)benzene-1,2-diol.
| Compound Name | 4-(4,5,6,7-tetrahydrofuro[3,2-c]pyridin-4-yl)benzene-1,2-diol |
|---|---|
| PubChem CID | 70431515 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 4-(4,5,6,7-tetrahydrofuro[3,2-c]pyridin-4-yl)benzene-1,2-diol |
| SMILES | Oc1ccc(C2NCCc3occc32)cc1O |
| InChI | InChI=1S/C13H13NO3/c15-10-2-1-8(7-11(10)16)13-9-4-6-17-12(9)3-5-14-13/h1-2,4,6-7,13-16H,3,5H2 |
| InChIKey | HNNFQZMHWHBMSL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|