About [4-(4-propanoyloxycyclohexyl)cyclohexyl] 2-propylthieno[2,3-b]thiophene-5-carboxylate
[4-(4-propanoyloxycyclohexyl)cyclohexyl] 2-propylthieno[2,3-b]thiophene-5-carboxylate (PubChem CID 70431634) has the molecular formula C25H34O4S2
and a molecular weight of 462.68 g/mol. Its IUPAC name is [4-(4-propanoyloxycyclohexyl)cyclohexyl] 2-propylthieno[2,3-b]thiophene-5-carboxylate.
Molecular Properties
| Compound Name | [4-(4-propanoyloxycyclohexyl)cyclohexyl] 2-propylthieno[2,3-b]thiophene-5-carboxylate |
| PubChem CID | 70431634 |
| Molecular Formula | C25H34O4S2 |
| Molecular Weight | 462.68 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | [4-(4-propanoyloxycyclohexyl)cyclohexyl] 2-propylthieno[2,3-b]thiophene-5-carboxylate |
| SMILES | CCCc1cc2cc(C(=O)OC3CCC(C4CCC(OC(=O)CC)CC4)CC3)sc2s1 |
| InChI | InChI=1S/C25H34O4S2/c1-3-5-21-14-18-15-22(31-25(18)30-21)24(27)29-20-12-8-17(9-13-20)16-6-10-19(11-7-16)28-23(26)4-2/h14-17,19-20H,3-13H2,1-2H3 |
| InChIKey | GADOHXWYKWMCBJ-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.68 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-(4-propanoyloxycyclohexyl)cyclohexyl] 2-propylthieno[2,3-b]thiophene-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-propanoyloxycyclohexyl)cyclohexyl] 2-propylthieno[2,3-b]thiophene-5-carboxylate?
The IUPAC name of [4-(4-propanoyloxycyclohexyl)cyclohexyl] 2-propylthieno[2,3-b]thiophene-5-carboxylate (CID 70431634) is [4-(4-propanoyloxycyclohexyl)cyclohexyl] 2-propylthieno[2,3-b]thiophene-5-carboxylate.
What is the SMILES notation for [4-(4-propanoyloxycyclohexyl)cyclohexyl] 2-propylthieno[2,3-b]thiophene-5-carboxylate?
The canonical SMILES for [4-(4-propanoyloxycyclohexyl)cyclohexyl] 2-propylthieno[2,3-b]thiophene-5-carboxylate is CCCc1cc2cc(C(=O)OC3CCC(C4CCC(OC(=O)CC)CC4)CC3)sc2s1.
What is the InChIKey of [4-(4-propanoyloxycyclohexyl)cyclohexyl] 2-propylthieno[2,3-b]thiophene-5-carboxylate?
The InChIKey is GADOHXWYKWMCBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H34O4S2/c1-3-5-21-14-18-15-22(31-25(18)30-21)24(27)29-20-12-8-17(9-13-20)16-6-10-19(11-7-16)28-23(26)4-2/h14-17,19-20H,3-13H2,1-2H3.
What are the key properties of [4-(4-propanoyloxycyclohexyl)cyclohexyl] 2-propylthieno[2,3-b]thiophene-5-carboxylate?
[4-(4-propanoyloxycyclohexyl)cyclohexyl] 2-propylthieno[2,3-b]thiophene-5-carboxylate has a molecular weight of 462.68 g/mol, XLogP of 7.14, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-propanoyloxycyclohexyl)cyclohexyl] 2-propylthieno[2,3-b]thiophene-5-carboxylate is sourced from PubChem (CID 70431634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).