About 3-[2-carboxylatoethyl-(4,5-dimethyl-1,3-thiazol-2-yl)amino]propanoate
3-[2-carboxylatoethyl-(4,5-dimethyl-1,3-thiazol-2-yl)amino]propanoate (PubChem CID 7043166) has the molecular formula C11H14N2O4S-2
and a molecular weight of 270.31 g/mol. Its IUPAC name is 3-[2-carboxylatoethyl-(4,5-dimethyl-1,3-thiazol-2-yl)amino]propanoate.
Molecular Properties
| Compound Name | 3-[2-carboxylatoethyl-(4,5-dimethyl-1,3-thiazol-2-yl)amino]propanoate |
| PubChem CID | 7043166 |
| Molecular Formula | C11H14N2O4S-2 |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 3-[2-carboxylatoethyl-(4,5-dimethyl-1,3-thiazol-2-yl)amino]propanoate |
| SMILES | Cc1nc(N(CCC(=O)[O-])CCC(=O)[O-])sc1C |
| InChI | InChI=1S/C11H16N2O4S/c1-7-8(2)18-11(12-7)13(5-3-9(14)15)6-4-10(16)17/h3-6H2,1-2H3,(H,14,15)(H,16,17)/p-2 |
| InChIKey | DVENKSWDWSNPPL-UHFFFAOYSA-L |
| XLogP | -1.15 |
| TPSA | 96.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[2-carboxylatoethyl-(4,5-dimethyl-1,3-thiazol-2-yl)amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-carboxylatoethyl-(4,5-dimethyl-1,3-thiazol-2-yl)amino]propanoate?
The IUPAC name of 3-[2-carboxylatoethyl-(4,5-dimethyl-1,3-thiazol-2-yl)amino]propanoate (CID 7043166) is 3-[2-carboxylatoethyl-(4,5-dimethyl-1,3-thiazol-2-yl)amino]propanoate.
What is the SMILES notation for 3-[2-carboxylatoethyl-(4,5-dimethyl-1,3-thiazol-2-yl)amino]propanoate?
The canonical SMILES for 3-[2-carboxylatoethyl-(4,5-dimethyl-1,3-thiazol-2-yl)amino]propanoate is Cc1nc(N(CCC(=O)[O-])CCC(=O)[O-])sc1C.
What is the InChIKey of 3-[2-carboxylatoethyl-(4,5-dimethyl-1,3-thiazol-2-yl)amino]propanoate?
The InChIKey is DVENKSWDWSNPPL-UHFFFAOYSA-L. The full InChI is InChI=1S/C11H16N2O4S/c1-7-8(2)18-11(12-7)13(5-3-9(14)15)6-4-10(16)17/h3-6H2,1-2H3,(H,14,15)(H,16,17)/p-2.
What are the key properties of 3-[2-carboxylatoethyl-(4,5-dimethyl-1,3-thiazol-2-yl)amino]propanoate?
3-[2-carboxylatoethyl-(4,5-dimethyl-1,3-thiazol-2-yl)amino]propanoate has a molecular weight of 270.31 g/mol, XLogP of -1.15, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-carboxylatoethyl-(4,5-dimethyl-1,3-thiazol-2-yl)amino]propanoate is sourced from PubChem (CID 7043166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).