C11H19N5O2 — CID 70432118
2-amino-6-butoxy-3-methyl-5,6,7,8-tetrahydropteridin-4-one (PubChem CID 70432118) has the molecular formula C11H19N5O2 and a molecular weight of 253.31 g/mol. Its IUPAC name is 2-amino-6-butoxy-3-methyl-5,6,7,8-tetrahydropteridin-4-one.
| Compound Name | 2-amino-6-butoxy-3-methyl-5,6,7,8-tetrahydropteridin-4-one |
|---|---|
| PubChem CID | 70432118 |
| Molecular Formula | C11H19N5O2 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 2-amino-6-butoxy-3-methyl-5,6,7,8-tetrahydropteridin-4-one |
| SMILES | CCCCOC1CNc2nc(N)n(C)c(=O)c2N1 |
| InChI | InChI=1S/C11H19N5O2/c1-3-4-5-18-7-6-13-9-8(14-7)10(17)16(2)11(12)15-9/h7,13-14H,3-6H2,1-2H3,(H2,12,15) |
| InChIKey | JHHGURXTHKTMLY-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 94.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|