C25H48O6Si — CID 70432200
6-[4-[tert-butyl(dimethyl)silyl]oxy-1,7-dioxaspiro[5.5]undecan-2-yl]-3-(methoxymethoxy)-2,4-dimethylhex-1-en-1-ol (PubChem CID 70432200) has the molecular formula C25H48O6Si and a molecular weight of 472.74 g/mol. Its IUPAC name is 6-[4-[tert-butyl(dimethyl)silyl]oxy-1,7-dioxaspiro[5.5]undecan-2-yl]-3-(methoxymethoxy)-2,4-dimethylhex-1-en-1-ol.
| Compound Name | 6-[4-[tert-butyl(dimethyl)silyl]oxy-1,7-dioxaspiro[5.5]undecan-2-yl]-3-(methoxymethoxy)-2,4-dimethylhex-1-en-1-ol |
|---|---|
| PubChem CID | 70432200 |
| Molecular Formula | C25H48O6Si |
| Molecular Weight | 472.74 g/mol |
| Exact Mass | 472.32 |
| IUPAC Name | 6-[4-[tert-butyl(dimethyl)silyl]oxy-1,7-dioxaspiro[5.5]undecan-2-yl]-3-(methoxymethoxy)-2,4-dimethylhex-1-en-1-ol |
| SMILES | COCOC(C(C)=CO)C(C)CCC1CC(O[Si](C)(C)C(C)(C)C)CC2(CCCCO2)O1 |
| InChI | InChI=1S/C25H48O6Si/c1-19(23(20(2)17-26)28-18-27-6)11-12-21-15-22(31-32(7,8)24(3,4)5)16-25(30-21)13-9-10-14-29-25/h17,19,21-23,26H,9-16,18H2,1-8H3 |
| InChIKey | RSDPCYDBZNWSHD-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.74 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|