C21H34N4O2 — CID 70432293
5-[(Z)-6-[(1S,2S,3S,4R)-3-(cycloheptyloxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hex-4-enyl]-2H-tetrazole (PubChem CID 70432293) has the molecular formula C21H34N4O2 and a molecular weight of 374.53 g/mol. Its IUPAC name is 5-[(Z)-6-[(1S,2S,3S,4R)-3-(cycloheptyloxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hex-4-enyl]-2H-tetrazole.
| Compound Name | 5-[(Z)-6-[(1S,2S,3S,4R)-3-(cycloheptyloxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hex-4-enyl]-2H-tetrazole |
|---|---|
| PubChem CID | 70432293 |
| Molecular Formula | C21H34N4O2 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | 5-[(Z)-6-[(1S,2S,3S,4R)-3-(cycloheptyloxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hex-4-enyl]-2H-tetrazole |
| SMILES | C(=C\C[C@H]1[C@@H](COC2CCCCCC2)[C@H]2CC[C@@H]1O2)\CCCc1nn[nH]n1 |
| InChI | InChI=1S/C21H34N4O2/c1-2-6-10-16(9-5-1)26-15-18-17(19-13-14-20(18)27-19)11-7-3-4-8-12-21-22-24-25-23-21/h3,7,16-20H,1-2,4-6,8-15H2,(H,22,23,24,25)/b7-3-/t17-,18+,19-,20+/m0/s1 |
| InChIKey | MUSLQBYBSSFCRR-OXOQLEMZSA-N |
| XLogP | 4.00 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|