C25H26F3N3O6 — CID 70432773
3-O-[2-(2,5-dimethyl-1H-pyrrol-3-yl)ethyl] 5-O-ethyl 2-methyl-4-(3-nitrophenyl)-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 70432773) has the molecular formula C25H26F3N3O6 and a molecular weight of 521.49 g/mol. Its IUPAC name is 3-O-[2-(2,5-dimethyl-1H-pyrrol-3-yl)ethyl] 5-O-ethyl 2-methyl-4-(3-nitrophenyl)-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-[2-(2,5-dimethyl-1H-pyrrol-3-yl)ethyl] 5-O-ethyl 2-methyl-4-(3-nitrophenyl)-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 70432773 |
| Molecular Formula | C25H26F3N3O6 |
| Molecular Weight | 521.49 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | 3-O-[2-(2,5-dimethyl-1H-pyrrol-3-yl)ethyl] 5-O-ethyl 2-methyl-4-(3-nitrophenyl)-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(F)(F)F)NC(C)=C(C(=O)OCCc2cc(C)[nH]c2C)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H26F3N3O6/c1-5-36-24(33)21-20(17-7-6-8-18(12-17)31(34)35)19(15(4)30-22(21)25(26,27)28)23(32)37-10-9-16-11-13(2)29-14(16)3/h6-8,11-12,20,29-30H,5,9-10H2,1-4H3 |
| InChIKey | QGBANLMBFBWCHO-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 123.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|