C14H21N — CID 70432920
2-methylidene-4-pentyl-4,5,6,7-tetrahydroindole (PubChem CID 70432920) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 2-methylidene-4-pentyl-4,5,6,7-tetrahydroindole.
| Compound Name | 2-methylidene-4-pentyl-4,5,6,7-tetrahydroindole |
|---|---|
| PubChem CID | 70432920 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 2-methylidene-4-pentyl-4,5,6,7-tetrahydroindole |
| SMILES | C=C1C=C2C(=N1)CCCC2CCCCC |
| InChI | InChI=1S/C14H21N/c1-3-4-5-7-12-8-6-9-14-13(12)10-11(2)15-14/h10,12H,2-9H2,1H3 |
| InChIKey | GQRHNDVVSKELFY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|