About 2-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]ethyl 2-aminoacetate
2-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]ethyl 2-aminoacetate (PubChem CID 70433041) has the molecular formula C11H18N2O4S
and a molecular weight of 274.34 g/mol. Its IUPAC name is 2-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]ethyl 2-aminoacetate.
Molecular Properties
| Compound Name | 2-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]ethyl 2-aminoacetate |
| PubChem CID | 70433041 |
| Molecular Formula | C11H18N2O4S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 2-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]ethyl 2-aminoacetate |
| SMILES | C[C@@H](O)[C@H]1C(=O)N2CC(CCOC(=O)CN)S[C@H]12 |
| InChI | InChI=1S/C11H18N2O4S/c1-6(14)9-10(16)13-5-7(18-11(9)13)2-3-17-8(15)4-12/h6-7,9,11,14H,2-5,12H2,1H3/t6-,7?,9+,11-/m1/s1 |
| InChIKey | ROQRAHQOVHVADA-BUAOBOIDSA-N |
| XLogP | -0.84 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]ethyl 2-aminoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]ethyl 2-aminoacetate?
The IUPAC name of 2-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]ethyl 2-aminoacetate (CID 70433041) is 2-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]ethyl 2-aminoacetate.
What is the SMILES notation for 2-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]ethyl 2-aminoacetate?
The canonical SMILES for 2-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]ethyl 2-aminoacetate is C[C@@H](O)[C@H]1C(=O)N2CC(CCOC(=O)CN)S[C@H]12.
What is the InChIKey of 2-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]ethyl 2-aminoacetate?
The InChIKey is ROQRAHQOVHVADA-BUAOBOIDSA-N. The full InChI is InChI=1S/C11H18N2O4S/c1-6(14)9-10(16)13-5-7(18-11(9)13)2-3-17-8(15)4-12/h6-7,9,11,14H,2-5,12H2,1H3/t6-,7?,9+,11-/m1/s1.
What are the key properties of 2-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]ethyl 2-aminoacetate?
2-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]ethyl 2-aminoacetate has a molecular weight of 274.34 g/mol, XLogP of -0.84, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]ethyl 2-aminoacetate is sourced from PubChem (CID 70433041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).