C13H21NO — CID 70433268
2-pentyl-4,5,6,7-tetrahydro-3H-isoindol-1-one (PubChem CID 70433268) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is 2-pentyl-4,5,6,7-tetrahydro-3H-isoindol-1-one.
| Compound Name | 2-pentyl-4,5,6,7-tetrahydro-3H-isoindol-1-one |
|---|---|
| PubChem CID | 70433268 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 2-pentyl-4,5,6,7-tetrahydro-3H-isoindol-1-one |
| SMILES | CCCCCN1CC2=C(CCCC2)C1=O |
| InChI | InChI=1S/C13H21NO/c1-2-3-6-9-14-10-11-7-4-5-8-12(11)13(14)15/h2-10H2,1H3 |
| InChIKey | URMHJYQENDNMOL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|