C23H40O4 — CID 70433838
(3aR,4S,5R,6aS)-4-[(E,1S)-4,4-dimethyl-1-(oxan-2-yloxy)oct-2-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol (PubChem CID 70433838) has the molecular formula C23H40O4 and a molecular weight of 380.57 g/mol. Its IUPAC name is (3aR,4S,5R,6aS)-4-[(E,1S)-4,4-dimethyl-1-(oxan-2-yloxy)oct-2-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol.
| Compound Name | (3aR,4S,5R,6aS)-4-[(E,1S)-4,4-dimethyl-1-(oxan-2-yloxy)oct-2-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
|---|---|
| PubChem CID | 70433838 |
| Molecular Formula | C23H40O4 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | (3aR,4S,5R,6aS)-4-[(E,1S)-4,4-dimethyl-1-(oxan-2-yloxy)oct-2-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
| SMILES | CCCCC(C)(C)/C=C/[C@H](OC1CCCCO1)[C@@H]1[C@H]2CC(O)O[C@H]2C[C@H]1C |
| InChI | InChI=1S/C23H40O4/c1-5-6-11-23(3,4)12-10-18(27-21-9-7-8-13-25-21)22-16(2)14-19-17(22)15-20(24)26-19/h10,12,16-22,24H,5-9,11,13-15H2,1-4H3/b12-10+/t16-,17+,18+,19+,20?,21?,22+/m1/s1 |
| InChIKey | UBXIPJVVZRKTRT-UHOHQMRKSA-N |
| XLogP | 5.05 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|