C21H27NO2 — CID 70433906
2-[(4R)-4-[(Z)-but-2-enyl]-1-ethyl-8-methyl-2,3,4,9-tetrahydrocarbazol-1-yl]acetic acid (PubChem CID 70433906) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is 2-[(4R)-4-[(Z)-but-2-enyl]-1-ethyl-8-methyl-2,3,4,9-tetrahydrocarbazol-1-yl]acetic acid.
| Compound Name | 2-[(4R)-4-[(Z)-but-2-enyl]-1-ethyl-8-methyl-2,3,4,9-tetrahydrocarbazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 70433906 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 2-[(4R)-4-[(Z)-but-2-enyl]-1-ethyl-8-methyl-2,3,4,9-tetrahydrocarbazol-1-yl]acetic acid |
| SMILES | C/C=C\C[C@H]1CCC(CC)(CC(=O)O)c2[nH]c3c(C)cccc3c21 |
| InChI | InChI=1S/C21H27NO2/c1-4-6-9-15-11-12-21(5-2,13-17(23)24)20-18(15)16-10-7-8-14(3)19(16)22-20/h4,6-8,10,15,22H,5,9,11-13H2,1-3H3,(H,23,24)/b6-4-/t15-,21?/m0/s1 |
| InChIKey | LHWVNZKPHDTEIV-FNSXLGPYSA-N |
| XLogP | 5.44 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|