About 7-(2,6-dimethyl-3-pyridinyl)-6-fluoroquinoline-2-carboxylic acid
7-(2,6-dimethyl-3-pyridinyl)-6-fluoroquinoline-2-carboxylic acid (PubChem CID 70434252) has the molecular formula C17H13FN2O2
and a molecular weight of 296.30 g/mol. Its IUPAC name is 7-(2,6-dimethyl-3-pyridinyl)-6-fluoroquinoline-2-carboxylic acid.
Molecular Properties
| Compound Name | 7-(2,6-dimethyl-3-pyridinyl)-6-fluoroquinoline-2-carboxylic acid |
| PubChem CID | 70434252 |
| Molecular Formula | C17H13FN2O2 |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 7-(2,6-dimethyl-3-pyridinyl)-6-fluoroquinoline-2-carboxylic acid |
| SMILES | Cc1ccc(-c2cc3nc(C(=O)O)ccc3cc2F)c(C)n1 |
| InChI | InChI=1S/C17H13FN2O2/c1-9-3-5-12(10(2)19-9)13-8-16-11(7-14(13)18)4-6-15(20-16)17(21)22/h3-8H,1-2H3,(H,21,22) |
| InChIKey | TZOKDHNZUNUOFE-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-(2,6-dimethyl-3-pyridinyl)-6-fluoroquinoline-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2,6-dimethyl-3-pyridinyl)-6-fluoroquinoline-2-carboxylic acid?
The IUPAC name of 7-(2,6-dimethyl-3-pyridinyl)-6-fluoroquinoline-2-carboxylic acid (CID 70434252) is 7-(2,6-dimethyl-3-pyridinyl)-6-fluoroquinoline-2-carboxylic acid.
What is the SMILES notation for 7-(2,6-dimethyl-3-pyridinyl)-6-fluoroquinoline-2-carboxylic acid?
The canonical SMILES for 7-(2,6-dimethyl-3-pyridinyl)-6-fluoroquinoline-2-carboxylic acid is Cc1ccc(-c2cc3nc(C(=O)O)ccc3cc2F)c(C)n1.
What is the InChIKey of 7-(2,6-dimethyl-3-pyridinyl)-6-fluoroquinoline-2-carboxylic acid?
The InChIKey is TZOKDHNZUNUOFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13FN2O2/c1-9-3-5-12(10(2)19-9)13-8-16-11(7-14(13)18)4-6-15(20-16)17(21)22/h3-8H,1-2H3,(H,21,22).
What are the key properties of 7-(2,6-dimethyl-3-pyridinyl)-6-fluoroquinoline-2-carboxylic acid?
7-(2,6-dimethyl-3-pyridinyl)-6-fluoroquinoline-2-carboxylic acid has a molecular weight of 296.30 g/mol, XLogP of 3.75, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2,6-dimethyl-3-pyridinyl)-6-fluoroquinoline-2-carboxylic acid is sourced from PubChem (CID 70434252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).