C19H15NO3 — CID 70434519
16-prop-2-enyl-10-oxa-16-azatetracyclo[9.7.0.03,8.013,17]octadeca-1(11),3,5,7,12,17-hexaene-2,15-dione (PubChem CID 70434519) has the molecular formula C19H15NO3 and a molecular weight of 305.33 g/mol. Its IUPAC name is 16-prop-2-enyl-10-oxa-16-azatetracyclo[9.7.0.03,8.013,17]octadeca-1(11),3,5,7,12,17-hexaene-2,15-dione.
| Compound Name | 16-prop-2-enyl-10-oxa-16-azatetracyclo[9.7.0.03,8.013,17]octadeca-1(11),3,5,7,12,17-hexaene-2,15-dione |
|---|---|
| PubChem CID | 70434519 |
| Molecular Formula | C19H15NO3 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 16-prop-2-enyl-10-oxa-16-azatetracyclo[9.7.0.03,8.013,17]octadeca-1(11),3,5,7,12,17-hexaene-2,15-dione |
| SMILES | C=CCN1C(=O)Cc2cc3c(cc21)C(=O)c1ccccc1CO3 |
| InChI | InChI=1S/C19H15NO3/c1-2-7-20-16-10-15-17(8-13(16)9-18(20)21)23-11-12-5-3-4-6-14(12)19(15)22/h2-6,8,10H,1,7,9,11H2 |
| InChIKey | JFZLOHGDYKJMEK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|