C21H36F2O3Si — CID 70434872
(3R,3aR,4R,6aS)-4-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-4-fluorooct-1-enyl]-3-fluoro-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 70434872) has the molecular formula C21H36F2O3Si and a molecular weight of 402.60 g/mol. Its IUPAC name is (3R,3aR,4R,6aS)-4-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-4-fluorooct-1-enyl]-3-fluoro-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3R,3aR,4R,6aS)-4-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-4-fluorooct-1-enyl]-3-fluoro-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 70434872 |
| Molecular Formula | C21H36F2O3Si |
| Molecular Weight | 402.60 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | (3R,3aR,4R,6aS)-4-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-4-fluorooct-1-enyl]-3-fluoro-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CCCCC(F)C(/C=C/[C@H]1CC[C@@H]2OC(=O)[C@H](F)[C@@H]21)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H36F2O3Si/c1-7-8-9-15(22)16(26-27(5,6)21(2,3)4)12-10-14-11-13-17-18(14)19(23)20(24)25-17/h10,12,14-19H,7-9,11,13H2,1-6H3/b12-10+/t14-,15?,16?,17-,18+,19+/m0/s1 |
| InChIKey | CPFFPLSAXYCEEG-MHJZIWPPSA-N |
| XLogP | 5.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.60 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|