C11H15NO4 — CID 70435112
[(2R,8R)-3,5-dioxo-2,6,7,8-tetrahydro-1H-pyrrolizin-2-yl] butanoate (PubChem CID 70435112) has the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. Its IUPAC name is [(2R,8R)-3,5-dioxo-2,6,7,8-tetrahydro-1H-pyrrolizin-2-yl] butanoate.
| Compound Name | [(2R,8R)-3,5-dioxo-2,6,7,8-tetrahydro-1H-pyrrolizin-2-yl] butanoate |
|---|---|
| PubChem CID | 70435112 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | [(2R,8R)-3,5-dioxo-2,6,7,8-tetrahydro-1H-pyrrolizin-2-yl] butanoate |
| SMILES | CCCC(=O)O[C@@H]1C[C@H]2CCC(=O)N2C1=O |
| InChI | InChI=1S/C11H15NO4/c1-2-3-10(14)16-8-6-7-4-5-9(13)12(7)11(8)15/h7-8H,2-6H2,1H3/t7-,8-/m1/s1 |
| InChIKey | YUGCVKOMBOAGFH-HTQZYQBOSA-N |
| XLogP | 0.62 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|