About (2E)-1-[cyclohexyl(methyl)amino]-3,7-dimethylocta-2,6-dien-1-ol
(2E)-1-[cyclohexyl(methyl)amino]-3,7-dimethylocta-2,6-dien-1-ol (PubChem CID 70435113) has the molecular formula C17H31NO
and a molecular weight of 265.44 g/mol. Its IUPAC name is (2E)-1-[cyclohexyl(methyl)amino]-3,7-dimethylocta-2,6-dien-1-ol.
Molecular Properties
| Compound Name | (2E)-1-[cyclohexyl(methyl)amino]-3,7-dimethylocta-2,6-dien-1-ol |
| PubChem CID | 70435113 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | (2E)-1-[cyclohexyl(methyl)amino]-3,7-dimethylocta-2,6-dien-1-ol |
| SMILES | CC(C)=CCC/C(C)=C/C(O)N(C)C1CCCCC1 |
| InChI | InChI=1S/C17H31NO/c1-14(2)9-8-10-15(3)13-17(19)18(4)16-11-6-5-7-12-16/h9,13,16-17,19H,5-8,10-12H2,1-4H3/b15-13+ |
| InChIKey | PXDZDWXGIRJMOD-FYWRMAATSA-N |
| XLogP | 4.26 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-1-[cyclohexyl(methyl)amino]-3,7-dimethylocta-2,6-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-1-[cyclohexyl(methyl)amino]-3,7-dimethylocta-2,6-dien-1-ol?
The IUPAC name of (2E)-1-[cyclohexyl(methyl)amino]-3,7-dimethylocta-2,6-dien-1-ol (CID 70435113) is (2E)-1-[cyclohexyl(methyl)amino]-3,7-dimethylocta-2,6-dien-1-ol.
What is the SMILES notation for (2E)-1-[cyclohexyl(methyl)amino]-3,7-dimethylocta-2,6-dien-1-ol?
The canonical SMILES for (2E)-1-[cyclohexyl(methyl)amino]-3,7-dimethylocta-2,6-dien-1-ol is CC(C)=CCC/C(C)=C/C(O)N(C)C1CCCCC1.
What is the InChIKey of (2E)-1-[cyclohexyl(methyl)amino]-3,7-dimethylocta-2,6-dien-1-ol?
The InChIKey is PXDZDWXGIRJMOD-FYWRMAATSA-N. The full InChI is InChI=1S/C17H31NO/c1-14(2)9-8-10-15(3)13-17(19)18(4)16-11-6-5-7-12-16/h9,13,16-17,19H,5-8,10-12H2,1-4H3/b15-13+.
What are the key properties of (2E)-1-[cyclohexyl(methyl)amino]-3,7-dimethylocta-2,6-dien-1-ol?
(2E)-1-[cyclohexyl(methyl)amino]-3,7-dimethylocta-2,6-dien-1-ol has a molecular weight of 265.44 g/mol, XLogP of 4.26, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-1-[cyclohexyl(methyl)amino]-3,7-dimethylocta-2,6-dien-1-ol is sourced from PubChem (CID 70435113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).