C20H29NO5 — CID 70435438
4-[3-(2,2-dimethyl-1,3-dioxolan-4-yl)propylamino]-3-oxo-6-phenylhexanoic acid (PubChem CID 70435438) has the molecular formula C20H29NO5 and a molecular weight of 363.45 g/mol. Its IUPAC name is 4-[3-(2,2-dimethyl-1,3-dioxolan-4-yl)propylamino]-3-oxo-6-phenylhexanoic acid.
| Compound Name | 4-[3-(2,2-dimethyl-1,3-dioxolan-4-yl)propylamino]-3-oxo-6-phenylhexanoic acid |
|---|---|
| PubChem CID | 70435438 |
| Molecular Formula | C20H29NO5 |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | 4-[3-(2,2-dimethyl-1,3-dioxolan-4-yl)propylamino]-3-oxo-6-phenylhexanoic acid |
| SMILES | CC1(C)OCC(CCCNC(CCc2ccccc2)C(=O)CC(=O)O)O1 |
| InChI | InChI=1S/C20H29NO5/c1-20(2)25-14-16(26-20)9-6-12-21-17(18(22)13-19(23)24)11-10-15-7-4-3-5-8-15/h3-5,7-8,16-17,21H,6,9-14H2,1-2H3,(H,23,24) |
| InChIKey | JYPREBYWAGIJBZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|