C21H37FO3Si — CID 70435754
(3aR,4R,6aS)-4-[(E,3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-fluorooct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 70435754) has the molecular formula C21H37FO3Si and a molecular weight of 384.61 g/mol. Its IUPAC name is (3aR,4R,6aS)-4-[(E,3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-fluorooct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R,6aS)-4-[(E,3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-fluorooct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 70435754 |
| Molecular Formula | C21H37FO3Si |
| Molecular Weight | 384.61 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | (3aR,4R,6aS)-4-[(E,3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-fluorooct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CCCCC(F)[C@@H](/C=C/[C@H]1CC[C@@H]2OC(=O)C[C@@H]21)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H37FO3Si/c1-7-8-9-17(22)19(25-26(5,6)21(2,3)4)13-11-15-10-12-18-16(15)14-20(23)24-18/h11,13,15-19H,7-10,12,14H2,1-6H3/b13-11+/t15-,16-,17?,18+,19-/m1/s1 |
| InChIKey | JBMHPFXPEFLCRE-RHDMDTBDSA-N |
| XLogP | 5.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.61 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|