C9H11NO4 — CID 70436064
[(2R,8R)-3,5-dioxo-2,6,7,8-tetrahydro-1H-pyrrolizin-2-yl] acetate (PubChem CID 70436064) has the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. Its IUPAC name is [(2R,8R)-3,5-dioxo-2,6,7,8-tetrahydro-1H-pyrrolizin-2-yl] acetate.
| Compound Name | [(2R,8R)-3,5-dioxo-2,6,7,8-tetrahydro-1H-pyrrolizin-2-yl] acetate |
|---|---|
| PubChem CID | 70436064 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | [(2R,8R)-3,5-dioxo-2,6,7,8-tetrahydro-1H-pyrrolizin-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@H]2CCC(=O)N2C1=O |
| InChI | InChI=1S/C9H11NO4/c1-5(11)14-7-4-6-2-3-8(12)10(6)9(7)13/h6-7H,2-4H2,1H3/t6-,7-/m1/s1 |
| InChIKey | JJLSFLBQVAFZAA-RNFRBKRXSA-N |
| XLogP | -0.16 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|