About 4-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethylamino]-3-oxo-6-phenylhexanoic acid
4-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethylamino]-3-oxo-6-phenylhexanoic acid (PubChem CID 70436183) has the molecular formula C19H27NO5
and a molecular weight of 349.43 g/mol. Its IUPAC name is 4-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethylamino]-3-oxo-6-phenylhexanoic acid.
Molecular Properties
| Compound Name | 4-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethylamino]-3-oxo-6-phenylhexanoic acid |
| PubChem CID | 70436183 |
| Molecular Formula | C19H27NO5 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 4-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethylamino]-3-oxo-6-phenylhexanoic acid |
| SMILES | CC1(C)OCC(CCNC(CCc2ccccc2)C(=O)CC(=O)O)O1 |
| InChI | InChI=1S/C19H27NO5/c1-19(2)24-13-15(25-19)10-11-20-16(17(21)12-18(22)23)9-8-14-6-4-3-5-7-14/h3-7,15-16,20H,8-13H2,1-2H3,(H,22,23) |
| InChIKey | YYUNPCAWEOCNAV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethylamino]-3-oxo-6-phenylhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethylamino]-3-oxo-6-phenylhexanoic acid?
The IUPAC name of 4-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethylamino]-3-oxo-6-phenylhexanoic acid (CID 70436183) is 4-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethylamino]-3-oxo-6-phenylhexanoic acid.
What is the SMILES notation for 4-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethylamino]-3-oxo-6-phenylhexanoic acid?
The canonical SMILES for 4-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethylamino]-3-oxo-6-phenylhexanoic acid is CC1(C)OCC(CCNC(CCc2ccccc2)C(=O)CC(=O)O)O1.
What is the InChIKey of 4-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethylamino]-3-oxo-6-phenylhexanoic acid?
The InChIKey is YYUNPCAWEOCNAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27NO5/c1-19(2)24-13-15(25-19)10-11-20-16(17(21)12-18(22)23)9-8-14-6-4-3-5-7-14/h3-7,15-16,20H,8-13H2,1-2H3,(H,22,23).
What are the key properties of 4-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethylamino]-3-oxo-6-phenylhexanoic acid?
4-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethylamino]-3-oxo-6-phenylhexanoic acid has a molecular weight of 349.43 g/mol, XLogP of 2.16, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethylamino]-3-oxo-6-phenylhexanoic acid is sourced from PubChem (CID 70436183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).