C15H16N2O5 — CID 70436617
but-2-enedioic acid;1-(2,3-dihydro-1-benzofuran-2-yl)-4,5-dihydroimidazole (PubChem CID 70436617) has the molecular formula C15H16N2O5 and a molecular weight of 304.30 g/mol. Its IUPAC name is but-2-enedioic acid;1-(2,3-dihydro-1-benzofuran-2-yl)-4,5-dihydroimidazole.
| Compound Name | but-2-enedioic acid;1-(2,3-dihydro-1-benzofuran-2-yl)-4,5-dihydroimidazole |
|---|---|
| PubChem CID | 70436617 |
| Molecular Formula | C15H16N2O5 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | but-2-enedioic acid;1-(2,3-dihydro-1-benzofuran-2-yl)-4,5-dihydroimidazole |
| SMILES | C1=NCCN1C1Cc2ccccc2O1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C11H12N2O.C4H4O4/c1-2-4-10-9(3-1)7-11(14-10)13-6-5-12-8-13;5-3(6)1-2-4(7)8/h1-4,8,11H,5-7H2;1-2H,(H,5,6)(H,7,8) |
| InChIKey | SJNXQXDOZBFXDZ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 99.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|