About bis[(6-chloro-4-methyl-1,3-benzothiazol-2-yl)sulfanyl] butanedioate
bis[(6-chloro-4-methyl-1,3-benzothiazol-2-yl)sulfanyl] butanedioate (PubChem CID 70436746) has the molecular formula C20H14Cl2N2O4S4
and a molecular weight of 545.52 g/mol. Its IUPAC name is bis[(6-chloro-4-methyl-1,3-benzothiazol-2-yl)sulfanyl] butanedioate.
Molecular Properties
| Compound Name | bis[(6-chloro-4-methyl-1,3-benzothiazol-2-yl)sulfanyl] butanedioate |
| PubChem CID | 70436746 |
| Molecular Formula | C20H14Cl2N2O4S4 |
| Molecular Weight | 545.52 g/mol |
| Exact Mass | 543.92 |
| IUPAC Name | bis[(6-chloro-4-methyl-1,3-benzothiazol-2-yl)sulfanyl] butanedioate |
| SMILES | Cc1cc(Cl)cc2sc(SOC(=O)CCC(=O)OSc3nc4c(C)cc(Cl)cc4s3)nc12 |
| InChI | InChI=1S/C20H14Cl2N2O4S4/c1-9-5-11(21)7-13-17(9)23-19(29-13)31-27-15(25)3-4-16(26)28-32-20-24-18-10(2)6-12(22)8-14(18)30-20/h5-8H,3-4H2,1-2H3 |
| InChIKey | JCFVXDJGAMXHLQ-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 545.52 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis[(6-chloro-4-methyl-1,3-benzothiazol-2-yl)sulfanyl] butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[(6-chloro-4-methyl-1,3-benzothiazol-2-yl)sulfanyl] butanedioate?
The IUPAC name of bis[(6-chloro-4-methyl-1,3-benzothiazol-2-yl)sulfanyl] butanedioate (CID 70436746) is bis[(6-chloro-4-methyl-1,3-benzothiazol-2-yl)sulfanyl] butanedioate.
What is the SMILES notation for bis[(6-chloro-4-methyl-1,3-benzothiazol-2-yl)sulfanyl] butanedioate?
The canonical SMILES for bis[(6-chloro-4-methyl-1,3-benzothiazol-2-yl)sulfanyl] butanedioate is Cc1cc(Cl)cc2sc(SOC(=O)CCC(=O)OSc3nc4c(C)cc(Cl)cc4s3)nc12.
What is the InChIKey of bis[(6-chloro-4-methyl-1,3-benzothiazol-2-yl)sulfanyl] butanedioate?
The InChIKey is JCFVXDJGAMXHLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14Cl2N2O4S4/c1-9-5-11(21)7-13-17(9)23-19(29-13)31-27-15(25)3-4-16(26)28-32-20-24-18-10(2)6-12(22)8-14(18)30-20/h5-8H,3-4H2,1-2H3.
What are the key properties of bis[(6-chloro-4-methyl-1,3-benzothiazol-2-yl)sulfanyl] butanedioate?
bis[(6-chloro-4-methyl-1,3-benzothiazol-2-yl)sulfanyl] butanedioate has a molecular weight of 545.52 g/mol, XLogP of 7.41, 7 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis[(6-chloro-4-methyl-1,3-benzothiazol-2-yl)sulfanyl] butanedioate is sourced from PubChem (CID 70436746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).