About ethyl N-[6-(3,6-dihydro-2H-pyridin-1-yl)-2-(2-ethyloxan-2-yl)-3-hydroxypyrimidin-4-ylidene]carbamate
ethyl N-[6-(3,6-dihydro-2H-pyridin-1-yl)-2-(2-ethyloxan-2-yl)-3-hydroxypyrimidin-4-ylidene]carbamate (PubChem CID 70436938) has the molecular formula C19H28N4O4
and a molecular weight of 376.46 g/mol. Its IUPAC name is ethyl N-[6-(3,6-dihydro-2H-pyridin-1-yl)-2-(2-ethyloxan-2-yl)-3-hydroxypyrimidin-4-ylidene]carbamate.
Molecular Properties
| Compound Name | ethyl N-[6-(3,6-dihydro-2H-pyridin-1-yl)-2-(2-ethyloxan-2-yl)-3-hydroxypyrimidin-4-ylidene]carbamate |
| PubChem CID | 70436938 |
| Molecular Formula | C19H28N4O4 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | ethyl N-[6-(3,6-dihydro-2H-pyridin-1-yl)-2-(2-ethyloxan-2-yl)-3-hydroxypyrimidin-4-ylidene]carbamate |
| SMILES | CCOC(=O)N=c1cc(N2CC=CCC2)nc(C2(CC)CCCCO2)n1O |
| InChI | InChI=1S/C19H28N4O4/c1-3-19(10-6-9-13-27-19)17-20-15(22-11-7-5-8-12-22)14-16(23(17)25)21-18(24)26-4-2/h5,7,14,25H,3-4,6,8-13H2,1-2H3 |
| InChIKey | NVFGUHLVJYAXPY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[6-(3,6-dihydro-2H-pyridin-1-yl)-2-(2-ethyloxan-2-yl)-3-hydroxypyrimidin-4-ylidene]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[6-(3,6-dihydro-2H-pyridin-1-yl)-2-(2-ethyloxan-2-yl)-3-hydroxypyrimidin-4-ylidene]carbamate?
The IUPAC name of ethyl N-[6-(3,6-dihydro-2H-pyridin-1-yl)-2-(2-ethyloxan-2-yl)-3-hydroxypyrimidin-4-ylidene]carbamate (CID 70436938) is ethyl N-[6-(3,6-dihydro-2H-pyridin-1-yl)-2-(2-ethyloxan-2-yl)-3-hydroxypyrimidin-4-ylidene]carbamate.
What is the SMILES notation for ethyl N-[6-(3,6-dihydro-2H-pyridin-1-yl)-2-(2-ethyloxan-2-yl)-3-hydroxypyrimidin-4-ylidene]carbamate?
The canonical SMILES for ethyl N-[6-(3,6-dihydro-2H-pyridin-1-yl)-2-(2-ethyloxan-2-yl)-3-hydroxypyrimidin-4-ylidene]carbamate is CCOC(=O)N=c1cc(N2CC=CCC2)nc(C2(CC)CCCCO2)n1O.
What is the InChIKey of ethyl N-[6-(3,6-dihydro-2H-pyridin-1-yl)-2-(2-ethyloxan-2-yl)-3-hydroxypyrimidin-4-ylidene]carbamate?
The InChIKey is NVFGUHLVJYAXPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28N4O4/c1-3-19(10-6-9-13-27-19)17-20-15(22-11-7-5-8-12-22)14-16(23(17)25)21-18(24)26-4-2/h5,7,14,25H,3-4,6,8-13H2,1-2H3.
What are the key properties of ethyl N-[6-(3,6-dihydro-2H-pyridin-1-yl)-2-(2-ethyloxan-2-yl)-3-hydroxypyrimidin-4-ylidene]carbamate?
ethyl N-[6-(3,6-dihydro-2H-pyridin-1-yl)-2-(2-ethyloxan-2-yl)-3-hydroxypyrimidin-4-ylidene]carbamate has a molecular weight of 376.46 g/mol, XLogP of 2.75, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[6-(3,6-dihydro-2H-pyridin-1-yl)-2-(2-ethyloxan-2-yl)-3-hydroxypyrimidin-4-ylidene]carbamate is sourced from PubChem (CID 70436938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).