C14H22N2O — CID 70437577
(4aS,8aR)-3,3-bis(prop-2-enyl)-1,4,4a,5,6,7,8,8a-octahydroquinoxalin-2-one (PubChem CID 70437577) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is (4aS,8aR)-3,3-bis(prop-2-enyl)-1,4,4a,5,6,7,8,8a-octahydroquinoxalin-2-one.
| Compound Name | (4aS,8aR)-3,3-bis(prop-2-enyl)-1,4,4a,5,6,7,8,8a-octahydroquinoxalin-2-one |
|---|---|
| PubChem CID | 70437577 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | (4aS,8aR)-3,3-bis(prop-2-enyl)-1,4,4a,5,6,7,8,8a-octahydroquinoxalin-2-one |
| SMILES | C=CCC1(CC=C)N[C@H]2CCCC[C@H]2NC1=O |
| InChI | InChI=1S/C14H22N2O/c1-3-9-14(10-4-2)13(17)15-11-7-5-6-8-12(11)16-14/h3-4,11-12,16H,1-2,5-10H2,(H,15,17)/t11-,12+/m1/s1 |
| InChIKey | PIGNQYHZVVTUME-NEPJUHHUSA-N |
| XLogP | 1.91 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|