C19H20N4O2S — CID 7043764
2-(4-cyano-3-ethylpyrido[1,2-a]benzimidazol-1-yl)sulfanyl-N-(2-methoxyethyl)acetamide (PubChem CID 7043764) has the molecular formula C19H20N4O2S and a molecular weight of 368.46 g/mol. Its IUPAC name is 2-(4-cyano-3-ethylpyrido[1,2-a]benzimidazol-1-yl)sulfanyl-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-(4-cyano-3-ethylpyrido[1,2-a]benzimidazol-1-yl)sulfanyl-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 7043764 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 2-(4-cyano-3-ethylpyrido[1,2-a]benzimidazol-1-yl)sulfanyl-N-(2-methoxyethyl)acetamide |
| SMILES | CCc1cc(SCC(=O)NCCOC)n2c(nc3ccccc32)c1C#N |
| InChI | InChI=1S/C19H20N4O2S/c1-3-13-10-18(26-12-17(24)21-8-9-25-2)23-16-7-5-4-6-15(16)22-19(23)14(13)11-20/h4-7,10H,3,8-9,12H2,1-2H3,(H,21,24) |
| InChIKey | ZNYQDIVAKYCOFI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|