About 4-(2-fluorophenyl)-N,N-dimethyl-1,4-dihydroisoquinolin-3-amine;hydrochloride
4-(2-fluorophenyl)-N,N-dimethyl-1,4-dihydroisoquinolin-3-amine;hydrochloride (PubChem CID 70437653) has the molecular formula C17H18ClFN2
and a molecular weight of 304.80 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-N,N-dimethyl-1,4-dihydroisoquinolin-3-amine;hydrochloride.
Molecular Properties
| Compound Name | 4-(2-fluorophenyl)-N,N-dimethyl-1,4-dihydroisoquinolin-3-amine;hydrochloride |
| PubChem CID | 70437653 |
| Molecular Formula | C17H18ClFN2 |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 4-(2-fluorophenyl)-N,N-dimethyl-1,4-dihydroisoquinolin-3-amine;hydrochloride |
| SMILES | CN(C)C1=NCc2ccccc2C1c1ccccc1F.Cl |
| InChI | InChI=1S/C17H17FN2.ClH/c1-20(2)17-16(14-9-5-6-10-15(14)18)13-8-4-3-7-12(13)11-19-17;/h3-10,16H,11H2,1-2H3;1H |
| InChIKey | JQYUVZOCYCXTPH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2-fluorophenyl)-N,N-dimethyl-1,4-dihydroisoquinolin-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-fluorophenyl)-N,N-dimethyl-1,4-dihydroisoquinolin-3-amine;hydrochloride?
The IUPAC name of 4-(2-fluorophenyl)-N,N-dimethyl-1,4-dihydroisoquinolin-3-amine;hydrochloride (CID 70437653) is 4-(2-fluorophenyl)-N,N-dimethyl-1,4-dihydroisoquinolin-3-amine;hydrochloride.
What is the SMILES notation for 4-(2-fluorophenyl)-N,N-dimethyl-1,4-dihydroisoquinolin-3-amine;hydrochloride?
The canonical SMILES for 4-(2-fluorophenyl)-N,N-dimethyl-1,4-dihydroisoquinolin-3-amine;hydrochloride is CN(C)C1=NCc2ccccc2C1c1ccccc1F.Cl.
What is the InChIKey of 4-(2-fluorophenyl)-N,N-dimethyl-1,4-dihydroisoquinolin-3-amine;hydrochloride?
The InChIKey is JQYUVZOCYCXTPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17FN2.ClH/c1-20(2)17-16(14-9-5-6-10-15(14)18)13-8-4-3-7-12(13)11-19-17;/h3-10,16H,11H2,1-2H3;1H.
What are the key properties of 4-(2-fluorophenyl)-N,N-dimethyl-1,4-dihydroisoquinolin-3-amine;hydrochloride?
4-(2-fluorophenyl)-N,N-dimethyl-1,4-dihydroisoquinolin-3-amine;hydrochloride has a molecular weight of 304.80 g/mol, XLogP of 3.85, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-fluorophenyl)-N,N-dimethyl-1,4-dihydroisoquinolin-3-amine;hydrochloride is sourced from PubChem (CID 70437653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).