About 1,2-dihydrofuro[2,3-d]pyrimidin-2-amine
1,2-dihydrofuro[2,3-d]pyrimidin-2-amine (PubChem CID 70437724) has the molecular formula C6H7N3O
and a molecular weight of 137.14 g/mol. Its IUPAC name is 1,2-dihydrofuro[2,3-d]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 1,2-dihydrofuro[2,3-d]pyrimidin-2-amine |
| PubChem CID | 70437724 |
| Molecular Formula | C6H7N3O |
| Molecular Weight | 137.14 g/mol |
| Exact Mass | 137.06 |
| IUPAC Name | 1,2-dihydrofuro[2,3-d]pyrimidin-2-amine |
| SMILES | NC1N=Cc2ccoc2N1 |
| InChI | InChI=1S/C6H7N3O/c7-6-8-3-4-1-2-10-5(4)9-6/h1-3,6,9H,7H2 |
| InChIKey | BBFOICPDLVULCA-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 63.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.14 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,2-dihydrofuro[2,3-d]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dihydrofuro[2,3-d]pyrimidin-2-amine?
The IUPAC name of 1,2-dihydrofuro[2,3-d]pyrimidin-2-amine (CID 70437724) is 1,2-dihydrofuro[2,3-d]pyrimidin-2-amine.
What is the SMILES notation for 1,2-dihydrofuro[2,3-d]pyrimidin-2-amine?
The canonical SMILES for 1,2-dihydrofuro[2,3-d]pyrimidin-2-amine is NC1N=Cc2ccoc2N1.
What is the InChIKey of 1,2-dihydrofuro[2,3-d]pyrimidin-2-amine?
The InChIKey is BBFOICPDLVULCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O/c7-6-8-3-4-1-2-10-5(4)9-6/h1-3,6,9H,7H2.
What are the key properties of 1,2-dihydrofuro[2,3-d]pyrimidin-2-amine?
1,2-dihydrofuro[2,3-d]pyrimidin-2-amine has a molecular weight of 137.14 g/mol, XLogP of 0.37, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dihydrofuro[2,3-d]pyrimidin-2-amine is sourced from PubChem (CID 70437724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).