About methyl 7-[(3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxycyclopenten-1-yl]heptanoate
methyl 7-[(3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxycyclopenten-1-yl]heptanoate (PubChem CID 70437827) has the molecular formula C19H36O4Si
and a molecular weight of 356.58 g/mol. Its IUPAC name is methyl 7-[(3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxycyclopenten-1-yl]heptanoate.
Molecular Properties
| Compound Name | methyl 7-[(3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxycyclopenten-1-yl]heptanoate |
| PubChem CID | 70437827 |
| Molecular Formula | C19H36O4Si |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | methyl 7-[(3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxycyclopenten-1-yl]heptanoate |
| SMILES | COC(=O)CCCCCCC1=C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1O |
| InChI | InChI=1S/C19H36O4Si/c1-19(2,3)24(5,6)23-16-13-15(17(20)14-16)11-9-7-8-10-12-18(21)22-4/h13,16-17,20H,7-12,14H2,1-6H3/t16-,17+/m1/s1 |
| InChIKey | JRBUVSXTWHFFJP-SJORKVTESA-N |
| XLogP | 4.58 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 7-[(3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxycyclopenten-1-yl]heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-[(3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxycyclopenten-1-yl]heptanoate?
The IUPAC name of methyl 7-[(3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxycyclopenten-1-yl]heptanoate (CID 70437827) is methyl 7-[(3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxycyclopenten-1-yl]heptanoate.
What is the SMILES notation for methyl 7-[(3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxycyclopenten-1-yl]heptanoate?
The canonical SMILES for methyl 7-[(3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxycyclopenten-1-yl]heptanoate is COC(=O)CCCCCCC1=C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1O.
What is the InChIKey of methyl 7-[(3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxycyclopenten-1-yl]heptanoate?
The InChIKey is JRBUVSXTWHFFJP-SJORKVTESA-N. The full InChI is InChI=1S/C19H36O4Si/c1-19(2,3)24(5,6)23-16-13-15(17(20)14-16)11-9-7-8-10-12-18(21)22-4/h13,16-17,20H,7-12,14H2,1-6H3/t16-,17+/m1/s1.
What are the key properties of methyl 7-[(3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxycyclopenten-1-yl]heptanoate?
methyl 7-[(3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxycyclopenten-1-yl]heptanoate has a molecular weight of 356.58 g/mol, XLogP of 4.58, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-[(3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxycyclopenten-1-yl]heptanoate is sourced from PubChem (CID 70437827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).