About 7H-triazolo[1,5-b]pyridazine-6-thione
7H-triazolo[1,5-b]pyridazine-6-thione (PubChem CID 70438076) has the molecular formula C5H4N4S
and a molecular weight of 152.18 g/mol. Its IUPAC name is 7H-triazolo[1,5-b]pyridazine-6-thione.
Molecular Properties
| Compound Name | 7H-triazolo[1,5-b]pyridazine-6-thione |
| PubChem CID | 70438076 |
| Molecular Formula | C5H4N4S |
| Molecular Weight | 152.18 g/mol |
| Exact Mass | 152.02 |
| IUPAC Name | 7H-triazolo[1,5-b]pyridazine-6-thione |
| SMILES | S=c1ccc2cnnn2[nH]1 |
| InChI | InChI=1S/C5H4N4S/c10-5-2-1-4-3-6-8-9(4)7-5/h1-3H,(H,7,10) |
| InChIKey | ZKSOEHBYTSACAD-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.18 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 7H-triazolo[1,5-b]pyridazine-6-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-triazolo[1,5-b]pyridazine-6-thione?
The IUPAC name of 7H-triazolo[1,5-b]pyridazine-6-thione (CID 70438076) is 7H-triazolo[1,5-b]pyridazine-6-thione.
What is the SMILES notation for 7H-triazolo[1,5-b]pyridazine-6-thione?
The canonical SMILES for 7H-triazolo[1,5-b]pyridazine-6-thione is S=c1ccc2cnnn2[nH]1.
What is the InChIKey of 7H-triazolo[1,5-b]pyridazine-6-thione?
The InChIKey is ZKSOEHBYTSACAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N4S/c10-5-2-1-4-3-6-8-9(4)7-5/h1-3H,(H,7,10).
What are the key properties of 7H-triazolo[1,5-b]pyridazine-6-thione?
7H-triazolo[1,5-b]pyridazine-6-thione has a molecular weight of 152.18 g/mol, XLogP of 0.79, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-triazolo[1,5-b]pyridazine-6-thione is sourced from PubChem (CID 70438076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).