C17H20FN3O4 — CID 70438217
6-fluoro-7-(4-hydroxypiperazin-1-yl)-4-oxo-1-propylquinoline-3-carboxylic acid (PubChem CID 70438217) has the molecular formula C17H20FN3O4 and a molecular weight of 349.36 g/mol. Its IUPAC name is 6-fluoro-7-(4-hydroxypiperazin-1-yl)-4-oxo-1-propylquinoline-3-carboxylic acid.
| Compound Name | 6-fluoro-7-(4-hydroxypiperazin-1-yl)-4-oxo-1-propylquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 70438217 |
| Molecular Formula | C17H20FN3O4 |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 6-fluoro-7-(4-hydroxypiperazin-1-yl)-4-oxo-1-propylquinoline-3-carboxylic acid |
| SMILES | CCCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCN(O)CC3)cc21 |
| InChI | InChI=1S/C17H20FN3O4/c1-2-3-20-10-12(17(23)24)16(22)11-8-13(18)15(9-14(11)20)19-4-6-21(25)7-5-19/h8-10,25H,2-7H2,1H3,(H,23,24) |
| InChIKey | KLGZFJOKGYIHSR-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |