About 2,8a-dihydro-1H-pyrano[2,3-d]pyrimidin-2-amine
2,8a-dihydro-1H-pyrano[2,3-d]pyrimidin-2-amine (PubChem CID 70438350) has the molecular formula C7H9N3O
and a molecular weight of 151.17 g/mol. Its IUPAC name is 2,8a-dihydro-1H-pyrano[2,3-d]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 2,8a-dihydro-1H-pyrano[2,3-d]pyrimidin-2-amine |
| PubChem CID | 70438350 |
| Molecular Formula | C7H9N3O |
| Molecular Weight | 151.17 g/mol |
| Exact Mass | 151.07 |
| IUPAC Name | 2,8a-dihydro-1H-pyrano[2,3-d]pyrimidin-2-amine |
| SMILES | NC1N=CC2=CC=COC2N1 |
| InChI | InChI=1S/C7H9N3O/c8-7-9-4-5-2-1-3-11-6(5)10-7/h1-4,6-7,10H,8H2 |
| InChIKey | MAJPJKKYVVVNPC-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.17 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,8a-dihydro-1H-pyrano[2,3-d]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,8a-dihydro-1H-pyrano[2,3-d]pyrimidin-2-amine?
The IUPAC name of 2,8a-dihydro-1H-pyrano[2,3-d]pyrimidin-2-amine (CID 70438350) is 2,8a-dihydro-1H-pyrano[2,3-d]pyrimidin-2-amine.
What is the SMILES notation for 2,8a-dihydro-1H-pyrano[2,3-d]pyrimidin-2-amine?
The canonical SMILES for 2,8a-dihydro-1H-pyrano[2,3-d]pyrimidin-2-amine is NC1N=CC2=CC=COC2N1.
What is the InChIKey of 2,8a-dihydro-1H-pyrano[2,3-d]pyrimidin-2-amine?
The InChIKey is MAJPJKKYVVVNPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O/c8-7-9-4-5-2-1-3-11-6(5)10-7/h1-4,6-7,10H,8H2.
What are the key properties of 2,8a-dihydro-1H-pyrano[2,3-d]pyrimidin-2-amine?
2,8a-dihydro-1H-pyrano[2,3-d]pyrimidin-2-amine has a molecular weight of 151.17 g/mol, XLogP of -0.30, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,8a-dihydro-1H-pyrano[2,3-d]pyrimidin-2-amine is sourced from PubChem (CID 70438350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).