C18H23N3O — CID 70438862
2,2-dimethyl-1-(2-methylphenyl)-4-(1H-1,2,4-triazol-5-yl)hept-6-en-3-one (PubChem CID 70438862) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is 2,2-dimethyl-1-(2-methylphenyl)-4-(1H-1,2,4-triazol-5-yl)hept-6-en-3-one.
| Compound Name | 2,2-dimethyl-1-(2-methylphenyl)-4-(1H-1,2,4-triazol-5-yl)hept-6-en-3-one |
|---|---|
| PubChem CID | 70438862 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 2,2-dimethyl-1-(2-methylphenyl)-4-(1H-1,2,4-triazol-5-yl)hept-6-en-3-one |
| SMILES | C=CCC(C(=O)C(C)(C)Cc1ccccc1C)c1ncn[nH]1 |
| InChI | InChI=1S/C18H23N3O/c1-5-8-15(17-19-12-20-21-17)16(22)18(3,4)11-14-10-7-6-9-13(14)2/h5-7,9-10,12,15H,1,8,11H2,2-4H3,(H,19,20,21) |
| InChIKey | IARNNENBCMUVPH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|