About [5-[(2,6-dimethylmorpholin-4-yl)methyl]-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate
[5-[(2,6-dimethylmorpholin-4-yl)methyl]-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate (PubChem CID 70438984) has the molecular formula C24H31N3O5
and a molecular weight of 441.53 g/mol. Its IUPAC name is [5-[(2,6-dimethylmorpholin-4-yl)methyl]-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate.
Molecular Properties
| Compound Name | [5-[(2,6-dimethylmorpholin-4-yl)methyl]-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate |
| PubChem CID | 70438984 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | [5-[(2,6-dimethylmorpholin-4-yl)methyl]-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate |
| SMILES | COCc1c(OC(=O)OC(C)C)ncc2[nH]c3cccc(CN4CC(C)OC(C)C4)c3c12 |
| InChI | InChI=1S/C24H31N3O5/c1-14(2)30-24(28)32-23-18(13-29-5)22-20(9-25-23)26-19-8-6-7-17(21(19)22)12-27-10-15(3)31-16(4)11-27/h6-9,14-16,26H,10-13H2,1-5H3 |
| InChIKey | QWGAIICSTXWKLK-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [5-[(2,6-dimethylmorpholin-4-yl)methyl]-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[(2,6-dimethylmorpholin-4-yl)methyl]-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate?
The IUPAC name of [5-[(2,6-dimethylmorpholin-4-yl)methyl]-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate (CID 70438984) is [5-[(2,6-dimethylmorpholin-4-yl)methyl]-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate.
What is the SMILES notation for [5-[(2,6-dimethylmorpholin-4-yl)methyl]-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate?
The canonical SMILES for [5-[(2,6-dimethylmorpholin-4-yl)methyl]-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate is COCc1c(OC(=O)OC(C)C)ncc2[nH]c3cccc(CN4CC(C)OC(C)C4)c3c12.
What is the InChIKey of [5-[(2,6-dimethylmorpholin-4-yl)methyl]-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate?
The InChIKey is QWGAIICSTXWKLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H31N3O5/c1-14(2)30-24(28)32-23-18(13-29-5)22-20(9-25-23)26-19-8-6-7-17(21(19)22)12-27-10-15(3)31-16(4)11-27/h6-9,14-16,26H,10-13H2,1-5H3.
What are the key properties of [5-[(2,6-dimethylmorpholin-4-yl)methyl]-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate?
[5-[(2,6-dimethylmorpholin-4-yl)methyl]-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate has a molecular weight of 441.53 g/mol, XLogP of 4.40, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[(2,6-dimethylmorpholin-4-yl)methyl]-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate is sourced from PubChem (CID 70438984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).