C27H36N2O4 — CID 70439503
5-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)propylamino]-2-(3,5-dimethoxyphenyl)-2-propan-2-ylpentanenitrile (PubChem CID 70439503) has the molecular formula C27H36N2O4 and a molecular weight of 452.60 g/mol. Its IUPAC name is 5-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)propylamino]-2-(3,5-dimethoxyphenyl)-2-propan-2-ylpentanenitrile.
| Compound Name | 5-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)propylamino]-2-(3,5-dimethoxyphenyl)-2-propan-2-ylpentanenitrile |
|---|---|
| PubChem CID | 70439503 |
| Molecular Formula | C27H36N2O4 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | 5-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)propylamino]-2-(3,5-dimethoxyphenyl)-2-propan-2-ylpentanenitrile |
| SMILES | COc1cc(OC)cc(C(C#N)(CCCNCCCc2ccc3c(c2)OCCO3)C(C)C)c1 |
| InChI | InChI=1S/C27H36N2O4/c1-20(2)27(19-28,22-16-23(30-3)18-24(17-22)31-4)10-6-12-29-11-5-7-21-8-9-25-26(15-21)33-14-13-32-25/h8-9,15-18,20,29H,5-7,10-14H2,1-4H3 |
| InChIKey | IZSQDZAPZHILQO-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 72.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|