About [(1S,4R)-3-(hydroxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methanol
[(1S,4R)-3-(hydroxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methanol (PubChem CID 70439866) has the molecular formula C8H14O3
and a molecular weight of 158.20 g/mol. Its IUPAC name is [(1S,4R)-3-(hydroxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methanol.
Molecular Properties
| Compound Name | [(1S,4R)-3-(hydroxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methanol |
| PubChem CID | 70439866 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | [(1S,4R)-3-(hydroxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methanol |
| SMILES | OCC1C(CO)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C8H14O3/c9-3-5-6(4-10)8-2-1-7(5)11-8/h5-10H,1-4H2/t5?,6?,7-,8+ |
| InChIKey | PTJQDBOAZMCIMB-HYNHDVCUSA-N |
| XLogP | -0.24 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(1S,4R)-3-(hydroxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,4R)-3-(hydroxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methanol?
The IUPAC name of [(1S,4R)-3-(hydroxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methanol (CID 70439866) is [(1S,4R)-3-(hydroxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methanol.
What is the SMILES notation for [(1S,4R)-3-(hydroxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methanol?
The canonical SMILES for [(1S,4R)-3-(hydroxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methanol is OCC1C(CO)[C@H]2CC[C@@H]1O2.
What is the InChIKey of [(1S,4R)-3-(hydroxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methanol?
The InChIKey is PTJQDBOAZMCIMB-HYNHDVCUSA-N. The full InChI is InChI=1S/C8H14O3/c9-3-5-6(4-10)8-2-1-7(5)11-8/h5-10H,1-4H2/t5?,6?,7-,8+.
What are the key properties of [(1S,4R)-3-(hydroxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methanol?
[(1S,4R)-3-(hydroxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methanol has a molecular weight of 158.20 g/mol, XLogP of -0.24, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,4R)-3-(hydroxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methanol is sourced from PubChem (CID 70439866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).