About [5-(diethylaminomethyl)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate
[5-(diethylaminomethyl)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate (PubChem CID 70439880) has the molecular formula C21H27N3O4
and a molecular weight of 385.46 g/mol. Its IUPAC name is [5-(diethylaminomethyl)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate.
Molecular Properties
| Compound Name | [5-(diethylaminomethyl)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate |
| PubChem CID | 70439880 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | [5-(diethylaminomethyl)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ncc2[nH]c3cccc(CN(CC)CC)c3c2c1COC |
| InChI | InChI=1S/C21H27N3O4/c1-5-24(6-2)12-14-9-8-10-16-18(14)19-15(13-26-4)20(22-11-17(19)23-16)28-21(25)27-7-3/h8-11,23H,5-7,12-13H2,1-4H3 |
| InChIKey | YWXFHIRUQPYGEV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [5-(diethylaminomethyl)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(diethylaminomethyl)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate?
The IUPAC name of [5-(diethylaminomethyl)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate (CID 70439880) is [5-(diethylaminomethyl)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate.
What is the SMILES notation for [5-(diethylaminomethyl)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate?
The canonical SMILES for [5-(diethylaminomethyl)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate is CCOC(=O)Oc1ncc2[nH]c3cccc(CN(CC)CC)c3c2c1COC.
What is the InChIKey of [5-(diethylaminomethyl)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate?
The InChIKey is YWXFHIRUQPYGEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27N3O4/c1-5-24(6-2)12-14-9-8-10-16-18(14)19-15(13-26-4)20(22-11-17(19)23-16)28-21(25)27-7-3/h8-11,23H,5-7,12-13H2,1-4H3.
What are the key properties of [5-(diethylaminomethyl)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate?
[5-(diethylaminomethyl)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate has a molecular weight of 385.46 g/mol, XLogP of 4.24, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(diethylaminomethyl)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate is sourced from PubChem (CID 70439880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).