About ethyl 3-(2,4-dichlorophenyl)-3-hydroxy-2-(pyrrolidin-1-ylcarbamoyl)prop-2-enoate
ethyl 3-(2,4-dichlorophenyl)-3-hydroxy-2-(pyrrolidin-1-ylcarbamoyl)prop-2-enoate (PubChem CID 70439991) has the molecular formula C16H18Cl2N2O4
and a molecular weight of 373.24 g/mol. Its IUPAC name is ethyl 3-(2,4-dichlorophenyl)-3-hydroxy-2-(pyrrolidin-1-ylcarbamoyl)prop-2-enoate.
Molecular Properties
| Compound Name | ethyl 3-(2,4-dichlorophenyl)-3-hydroxy-2-(pyrrolidin-1-ylcarbamoyl)prop-2-enoate |
| PubChem CID | 70439991 |
| Molecular Formula | C16H18Cl2N2O4 |
| Molecular Weight | 373.24 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | ethyl 3-(2,4-dichlorophenyl)-3-hydroxy-2-(pyrrolidin-1-ylcarbamoyl)prop-2-enoate |
| SMILES | CCOC(=O)C(C(=O)NN1CCCC1)=C(O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H18Cl2N2O4/c1-2-24-16(23)13(15(22)19-20-7-3-4-8-20)14(21)11-6-5-10(17)9-12(11)18/h5-6,9,21H,2-4,7-8H2,1H3,(H,19,22) |
| InChIKey | BQAPHLDERHDQTN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.24 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-(2,4-dichlorophenyl)-3-hydroxy-2-(pyrrolidin-1-ylcarbamoyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(2,4-dichlorophenyl)-3-hydroxy-2-(pyrrolidin-1-ylcarbamoyl)prop-2-enoate?
The IUPAC name of ethyl 3-(2,4-dichlorophenyl)-3-hydroxy-2-(pyrrolidin-1-ylcarbamoyl)prop-2-enoate (CID 70439991) is ethyl 3-(2,4-dichlorophenyl)-3-hydroxy-2-(pyrrolidin-1-ylcarbamoyl)prop-2-enoate.
What is the SMILES notation for ethyl 3-(2,4-dichlorophenyl)-3-hydroxy-2-(pyrrolidin-1-ylcarbamoyl)prop-2-enoate?
The canonical SMILES for ethyl 3-(2,4-dichlorophenyl)-3-hydroxy-2-(pyrrolidin-1-ylcarbamoyl)prop-2-enoate is CCOC(=O)C(C(=O)NN1CCCC1)=C(O)c1ccc(Cl)cc1Cl.
What is the InChIKey of ethyl 3-(2,4-dichlorophenyl)-3-hydroxy-2-(pyrrolidin-1-ylcarbamoyl)prop-2-enoate?
The InChIKey is BQAPHLDERHDQTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18Cl2N2O4/c1-2-24-16(23)13(15(22)19-20-7-3-4-8-20)14(21)11-6-5-10(17)9-12(11)18/h5-6,9,21H,2-4,7-8H2,1H3,(H,19,22).
What are the key properties of ethyl 3-(2,4-dichlorophenyl)-3-hydroxy-2-(pyrrolidin-1-ylcarbamoyl)prop-2-enoate?
ethyl 3-(2,4-dichlorophenyl)-3-hydroxy-2-(pyrrolidin-1-ylcarbamoyl)prop-2-enoate has a molecular weight of 373.24 g/mol, XLogP of 2.95, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(2,4-dichlorophenyl)-3-hydroxy-2-(pyrrolidin-1-ylcarbamoyl)prop-2-enoate is sourced from PubChem (CID 70439991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).