C36H62O16Si2 — CID 70439998
[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[(2R,3R,4S,5R,6S)-5-acetyloxy-2-(acetyloxymethyl)-4-ethyl-3,6-bis(2-trimethylsilylethoxy)oxan-3-yl]oxan-2-yl]methyl acetate (PubChem CID 70439998) has the molecular formula C36H62O16Si2 and a molecular weight of 807.05 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[(2R,3R,4S,5R,6S)-5-acetyloxy-2-(acetyloxymethyl)-4-ethyl-3,6-bis(2-trimethylsilylethoxy)oxan-3-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[(2R,3R,4S,5R,6S)-5-acetyloxy-2-(acetyloxymethyl)-4-ethyl-3,6-bis(2-trimethylsilylethoxy)oxan-3-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 70439998 |
| Molecular Formula | C36H62O16Si2 |
| Molecular Weight | 807.05 g/mol |
| Exact Mass | 806.36 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[(2R,3R,4S,5R,6S)-5-acetyloxy-2-(acetyloxymethyl)-4-ethyl-3,6-bis(2-trimethylsilylethoxy)oxan-3-yl]oxan-2-yl]methyl acetate |
| SMILES | CC[C@H]1[C@@H](OC(C)=O)[C@@H](OCC[Si](C)(C)C)O[C@H](COC(C)=O)[C@@]1(OCC[Si](C)(C)C)[C@@H]1O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C36H62O16Si2/c1-14-27-30(47-23(4)39)35(43-15-17-53(8,9)10)52-29(20-45-22(3)38)36(27,46-16-18-54(11,12)13)34-33(50-26(7)42)32(49-25(6)41)31(48-24(5)40)28(51-34)19-44-21(2)37/h27-35H,14-20H2,1-13H3/t27-,28+,29+,30+,31-,32-,33+,34+,35-,36+/m0/s1 |
| InChIKey | ABIPGUCLSMEPBS-KKHHFKLXSA-N |
| XLogP | 3.81 |
| TPSA | 194.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.05 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|