About (2-methylpyran-2-yl) hydrogen carbonate
(2-methylpyran-2-yl) hydrogen carbonate (PubChem CID 70440239) has the molecular formula C7H8O4
and a molecular weight of 156.14 g/mol. Its IUPAC name is (2-methylpyran-2-yl) hydrogen carbonate.
Molecular Properties
| Compound Name | (2-methylpyran-2-yl) hydrogen carbonate |
| PubChem CID | 70440239 |
| Molecular Formula | C7H8O4 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | (2-methylpyran-2-yl) hydrogen carbonate |
| SMILES | CC1(OC(=O)O)C=CC=CO1 |
| InChI | InChI=1S/C7H8O4/c1-7(11-6(8)9)4-2-3-5-10-7/h2-5H,1H3,(H,8,9) |
| InChIKey | JTSDQYYLSCZYGM-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-methylpyran-2-yl) hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylpyran-2-yl) hydrogen carbonate?
The IUPAC name of (2-methylpyran-2-yl) hydrogen carbonate (CID 70440239) is (2-methylpyran-2-yl) hydrogen carbonate.
What is the SMILES notation for (2-methylpyran-2-yl) hydrogen carbonate?
The canonical SMILES for (2-methylpyran-2-yl) hydrogen carbonate is CC1(OC(=O)O)C=CC=CO1.
What is the InChIKey of (2-methylpyran-2-yl) hydrogen carbonate?
The InChIKey is JTSDQYYLSCZYGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O4/c1-7(11-6(8)9)4-2-3-5-10-7/h2-5H,1H3,(H,8,9).
What are the key properties of (2-methylpyran-2-yl) hydrogen carbonate?
(2-methylpyran-2-yl) hydrogen carbonate has a molecular weight of 156.14 g/mol, XLogP of 1.50, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylpyran-2-yl) hydrogen carbonate is sourced from PubChem (CID 70440239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).