About ethyl 5-(1-aminocyclopropyl)-6,7,8-trifluoro-4-oxo-1H-quinoline-3-carboxylate
ethyl 5-(1-aminocyclopropyl)-6,7,8-trifluoro-4-oxo-1H-quinoline-3-carboxylate (PubChem CID 70440355) has the molecular formula C15H13F3N2O3
and a molecular weight of 326.27 g/mol. Its IUPAC name is ethyl 5-(1-aminocyclopropyl)-6,7,8-trifluoro-4-oxo-1H-quinoline-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-(1-aminocyclopropyl)-6,7,8-trifluoro-4-oxo-1H-quinoline-3-carboxylate |
| PubChem CID | 70440355 |
| Molecular Formula | C15H13F3N2O3 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | ethyl 5-(1-aminocyclopropyl)-6,7,8-trifluoro-4-oxo-1H-quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c[nH]c2c(F)c(F)c(F)c(C3(N)CC3)c2c1=O |
| InChI | InChI=1S/C15H13F3N2O3/c1-2-23-14(22)6-5-20-12-7(13(6)21)8(15(19)3-4-15)9(16)10(17)11(12)18/h5H,2-4,19H2,1H3,(H,20,21) |
| InChIKey | MPGOEQAVKULOAH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 85.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-(1-aminocyclopropyl)-6,7,8-trifluoro-4-oxo-1H-quinoline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(1-aminocyclopropyl)-6,7,8-trifluoro-4-oxo-1H-quinoline-3-carboxylate?
The IUPAC name of ethyl 5-(1-aminocyclopropyl)-6,7,8-trifluoro-4-oxo-1H-quinoline-3-carboxylate (CID 70440355) is ethyl 5-(1-aminocyclopropyl)-6,7,8-trifluoro-4-oxo-1H-quinoline-3-carboxylate.
What is the SMILES notation for ethyl 5-(1-aminocyclopropyl)-6,7,8-trifluoro-4-oxo-1H-quinoline-3-carboxylate?
The canonical SMILES for ethyl 5-(1-aminocyclopropyl)-6,7,8-trifluoro-4-oxo-1H-quinoline-3-carboxylate is CCOC(=O)c1c[nH]c2c(F)c(F)c(F)c(C3(N)CC3)c2c1=O.
What is the InChIKey of ethyl 5-(1-aminocyclopropyl)-6,7,8-trifluoro-4-oxo-1H-quinoline-3-carboxylate?
The InChIKey is MPGOEQAVKULOAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13F3N2O3/c1-2-23-14(22)6-5-20-12-7(13(6)21)8(15(19)3-4-15)9(16)10(17)11(12)18/h5H,2-4,19H2,1H3,(H,20,21).
What are the key properties of ethyl 5-(1-aminocyclopropyl)-6,7,8-trifluoro-4-oxo-1H-quinoline-3-carboxylate?
ethyl 5-(1-aminocyclopropyl)-6,7,8-trifluoro-4-oxo-1H-quinoline-3-carboxylate has a molecular weight of 326.27 g/mol, XLogP of 2.07, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(1-aminocyclopropyl)-6,7,8-trifluoro-4-oxo-1H-quinoline-3-carboxylate is sourced from PubChem (CID 70440355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).