[3-[(2,3-difluorophenyl)methyl]imidazol-4-yl] hydrogen carbonate

C11H8F2N2O3 — CID 70440444

IUPAC[3-[(2,3-difluorophenyl)methyl]imidazol-4-yl] hydrogen carbonate
SMILESO=C(O)Oc1cncn1Cc1cccc(F)c1F
InChIInChI=1S/C11H8F2N2O3/c12-8-3-1-2-7(10(8)13)5-15-6-14-4-9(15)18-11(16)17/h1-4,6H,5H2,(H,16,17)
InChIKeyHQZAMYDCQQXWOE-UHFFFAOYSA-N
MW254.19 g/mol
LogP2.27
Rot. Bonds3

About [3-[(2,3-difluorophenyl)methyl]imidazol-4-yl] hydrogen carbonate

[3-[(2,3-difluorophenyl)methyl]imidazol-4-yl] hydrogen carbonate (PubChem CID 70440444) has the molecular formula C11H8F2N2O3 and a molecular weight of 254.19 g/mol. Its IUPAC name is [3-[(2,3-difluorophenyl)methyl]imidazol-4-yl] hydrogen carbonate.

Molecular Properties

Compound Name[3-[(2,3-difluorophenyl)methyl]imidazol-4-yl] hydrogen carbonate
PubChem CID70440444
Molecular FormulaC11H8F2N2O3
Molecular Weight254.19 g/mol
Exact Mass254.05
IUPAC Name[3-[(2,3-difluorophenyl)methyl]imidazol-4-yl] hydrogen carbonate
SMILESO=C(O)Oc1cncn1Cc1cccc(F)c1F
InChIInChI=1S/C11H8F2N2O3/c12-8-3-1-2-7(10(8)13)5-15-6-14-4-9(15)18-11(16)17/h1-4,6H,5H2,(H,16,17)
InChIKeyHQZAMYDCQQXWOE-UHFFFAOYSA-N
XLogP2.27
TPSA64.35 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.19
LogP ≤ 52.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze [3-[(2,3-difluorophenyl)methyl]imidazol-4-yl] hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [3-[(2,3-difluorophenyl)methyl]imidazol-4-yl] hydrogen carbonate?
The IUPAC name of [3-[(2,3-difluorophenyl)methyl]imidazol-4-yl] hydrogen carbonate (CID 70440444) is [3-[(2,3-difluorophenyl)methyl]imidazol-4-yl] hydrogen carbonate.
What is the SMILES notation for [3-[(2,3-difluorophenyl)methyl]imidazol-4-yl] hydrogen carbonate?
The canonical SMILES for [3-[(2,3-difluorophenyl)methyl]imidazol-4-yl] hydrogen carbonate is O=C(O)Oc1cncn1Cc1cccc(F)c1F.
What is the InChIKey of [3-[(2,3-difluorophenyl)methyl]imidazol-4-yl] hydrogen carbonate?
The InChIKey is HQZAMYDCQQXWOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8F2N2O3/c12-8-3-1-2-7(10(8)13)5-15-6-14-4-9(15)18-11(16)17/h1-4,6H,5H2,(H,16,17).
What are the key properties of [3-[(2,3-difluorophenyl)methyl]imidazol-4-yl] hydrogen carbonate?
[3-[(2,3-difluorophenyl)methyl]imidazol-4-yl] hydrogen carbonate has a molecular weight of 254.19 g/mol, XLogP of 2.27, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(2,3-difluorophenyl)methyl]imidazol-4-yl] hydrogen carbonate is sourced from PubChem (CID 70440444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).