C17H24FNO3 — CID 70440526
1-benzyl-4-(diethoxymethyl)-3-(2-fluoroethyl)azetidin-2-one (PubChem CID 70440526) has the molecular formula C17H24FNO3 and a molecular weight of 309.38 g/mol. Its IUPAC name is 1-benzyl-4-(diethoxymethyl)-3-(2-fluoroethyl)azetidin-2-one.
| Compound Name | 1-benzyl-4-(diethoxymethyl)-3-(2-fluoroethyl)azetidin-2-one |
|---|---|
| PubChem CID | 70440526 |
| Molecular Formula | C17H24FNO3 |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 1-benzyl-4-(diethoxymethyl)-3-(2-fluoroethyl)azetidin-2-one |
| SMILES | CCOC(OCC)C1C(CCF)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C17H24FNO3/c1-3-21-17(22-4-2)15-14(10-11-18)16(20)19(15)12-13-8-6-5-7-9-13/h5-9,14-15,17H,3-4,10-12H2,1-2H3 |
| InChIKey | XTCKQIKIFYJXGG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|